CAS 1223392-78-6 is the registry number for 1-((5-Methylisoxazol-3-yl)methyl)-1H-1,2,4-triazole-3-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2,4-triazole-3-carbonitrile (CAS 1223392-78-6) is a chemical compound with the molecular formula C8H7N5O and a molecular weight of 189.17 g/mol. IUPAC name: 1-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2,4-triazole-3-carbonitrile. InChIKey: CSAWMCBOHUCNOM-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2,4-triazole-3-carbonitrile |
| InChIKey | CSAWMCBOHUCNOM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)CN2C=NC(=N2)C#N |
Computed by PubChem (NCBI)