CAS 90029-73-5 appears in our catalog under these names: 3-(6-Amino-9H-purin-9-yl)acrylaldehyde, 97%, 3-(6-Amino-9H-purin-9-yl)-2-propenal. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
(E)-3-(6-aminopurin-9-yl)prop-2-enal (CAS 90029-73-5) is a chemical compound with the molecular formula C8H7N5O and a molecular weight of 189.17 g/mol. IUPAC name: (E)-3-(6-aminopurin-9-yl)prop-2-enal. InChIKey: LYXOMQKQLZJTQN-OWOJBTEDSA-N.
| Molecular formula | C8H7N5O |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | (E)-3-(6-aminopurin-9-yl)prop-2-enal |
| InChIKey | LYXOMQKQLZJTQN-OWOJBTEDSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)/C=C/C=O)N |
Computed by PubChem (NCBI)