CAS 1341558-50-6 is the registry number for 2-{1-Methyl-4-oxo-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-5-yl}acetonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetonitrile (CAS 1341558-50-6) is a chemical compound with the molecular formula C8H7N5O and a molecular weight of 189.17 g/mol. IUPAC name: 2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetonitrile. InChIKey: FJPBUXXWZHXPSF-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetonitrile |
| InChIKey | FJPBUXXWZHXPSF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)N(C=N2)CC#N |
Computed by PubChem (NCBI)