CAS 122374-27-0 is the registry number for N-(4-Sulfanylphenyl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-(4-sulfanylphenyl)methanesulfonamide (CAS 122374-27-0) is a chemical compound with the molecular formula C7H9NO2S2 and a molecular weight of 203.3 g/mol. IUPAC name: N-(4-sulfanylphenyl)methanesulfonamide. InChIKey: UBHLUCLNITXANH-UHFFFAOYSA-N.
| Molecular formula | C7H9NO2S2 |
|---|---|
| Molecular weight | 203.3 g/mol |
| IUPAC name | N-(4-sulfanylphenyl)methanesulfonamide |
| InChIKey | UBHLUCLNITXANH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)S |
Computed by PubChem (NCBI)