CAS 405150-23-4 is the registry number for (R)-2-Amino-3-(thiophen-2-ylthio)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-3-thiophen-2-ylsulfanylpropanoic acid (CAS 405150-23-4) is a chemical compound with the molecular formula C7H9NO2S2 and a molecular weight of 203.3 g/mol. IUPAC name: (2R)-2-amino-3-thiophen-2-ylsulfanylpropanoic acid. InChIKey: XRPOWEFAFQZLRI-YFKPBYRVSA-N.
| Molecular formula | C7H9NO2S2 |
|---|---|
| Molecular weight | 203.3 g/mol |
| IUPAC name | (2R)-2-amino-3-thiophen-2-ylsulfanylpropanoic acid |
| InChIKey | XRPOWEFAFQZLRI-YFKPBYRVSA-N |
| SMILES | C1=CSC(=C1)SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)