Products 473827-75-7

CAS 473827-75-7 is the registry number for Methyl 3,4-dimethyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carboxylate (CAS 473827-75-7) is a chemical compound with the molecular formula C7H9NO2S2 and a molecular weight of 203.3 g/mol. IUPAC name: methyl 3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carboxylate. InChIKey: VFLRRXMFSGVOSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO2S2
Molecular weight203.3 g/mol
IUPAC namemethyl 3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carboxylate
InChIKeyVFLRRXMFSGVOSJ-UHFFFAOYSA-N
SMILESCC1=C(SC(=S)N1C)C(=O)OC

Computed by PubChem (NCBI)