CAS 122376-68-5 is the registry number for Chlorphenamine Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-2-pyridin-2-ylacetonitrile (CAS 122376-68-5) is a chemical compound with the molecular formula C13H9ClN2 and a molecular weight of 228.67 g/mol. IUPAC name: 2-(3-chlorophenyl)-2-pyridin-2-ylacetonitrile. InChIKey: FUHXVPUFJPAPMS-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-2-pyridin-2-ylacetonitrile |
| InChIKey | FUHXVPUFJPAPMS-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C#N)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)