Products 23168-76-5
CAS 23168-76-5 is the registry number for 2-(6-(4-Chlorophenyl)pyridin-2-yl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[6-(4-chlorophenyl)-2-pyridinyl]acetonitrile (CAS 23168-76-5) is a chemical compound with the molecular formula C13H9ClN2 and a molecular weight of 228.67 g/mol. IUPAC name: 2-[6-(4-chlorophenyl)-2-pyridinyl]acetonitrile. InChIKey: FFEUXMNEDHKIQU-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 2-[6-(4-chlorophenyl)-2-pyridinyl]acetonitrile |
| InChIKey | FFEUXMNEDHKIQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C2=CC=C(C=C2)Cl)CC#N |
Computed by PubChem (NCBI)