Products 237435-19-7
CAS 237435-19-7 appears in our catalog under these names: 7-Chloro-2-phenyl-1h-pyrrolo[3,2-b]pyridine, 95%, 7-Chloro-2-phenyl-1H-pyrrolo(3,2-b)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-chloro-2-phenyl-1H-pyrrolo[3,2-b]pyridine (CAS 237435-19-7) is a chemical compound with the molecular formula C13H9ClN2 and a molecular weight of 228.67 g/mol. IUPAC name: 7-chloro-2-phenyl-1H-pyrrolo[3,2-b]pyridine. InChIKey: JESBRNMJLZZVBD-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 7-chloro-2-phenyl-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | JESBRNMJLZZVBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=NC=CC(=C3N2)Cl |
Computed by PubChem (NCBI)