CAS 1224194-44-8 appears in our catalog under these names: 2-(tert-Butoxycarbonylamino)-6-chloronicotinic acid, 95%, 2–(tert–Butoxycarbonyl)–6–chloronicotinic acid, 2-(tert-Butoxycarbonylamino)-6-chloronicotinic acid, 95%, 95%, 2-Boc-amino-6-chloro-nicotinic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid (CAS 1224194-44-8) is a chemical compound with the molecular formula C11H13ClN2O4 and a molecular weight of 272.68 g/mol. IUPAC name: 6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid. InChIKey: VTQPHEBAPHGVEQ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O4 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid |
| InChIKey | VTQPHEBAPHGVEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)