CAS 1803604-28-5 is the registry number for (6-Chloropyridin-3-yl)(cyclopropyl)methanamine, oxalic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(6-chloro-3-pyridinyl)-cyclopropylmethanamine;oxalic acid (CAS 1803604-28-5) is a chemical compound with the molecular formula C11H13ClN2O4 and a molecular weight of 272.68 g/mol. IUPAC name: (6-chloro-3-pyridinyl)-cyclopropylmethanamine;oxalic acid. InChIKey: YAZUDFAROMSQRW-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O4 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | (6-chloro-3-pyridinyl)-cyclopropylmethanamine;oxalic acid |
| InChIKey | YAZUDFAROMSQRW-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CN=C(C=C2)Cl)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)