CAS 885277-14-5 is the registry number for 5-tert-Butoxycarbonylamino-2-chloro-nicotinic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid (CAS 885277-14-5) is a chemical compound with the molecular formula C11H13ClN2O4 and a molecular weight of 272.68 g/mol. IUPAC name: 2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid. InChIKey: ZIRGYJUCMVPSLA-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O4 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid |
| InChIKey | ZIRGYJUCMVPSLA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(N=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)