Products 122432-93-3
CAS 122432-93-3 is the registry number for MP 518. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-2-hydroxyacetamide (CAS 122432-93-3) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-2-hydroxyacetamide. InChIKey: HYGXARKQZYBDIW-GHXNOFRVSA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-2-hydroxyacetamide |
| InChIKey | HYGXARKQZYBDIW-GHXNOFRVSA-N |
| SMILES | C/C(=N/NC(=O)CO)/C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)