CAS 122439-97-8 is the registry number for 4-((2,4-Diaminopyrimidin-5-yl)methyl)-2-methoxyphenol hydrobromide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenol;hydrobromide (CAS 122439-97-8) is a chemical compound with the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. IUPAC name: 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenol;hydrobromide. InChIKey: GHBRBLNGRSGPEP-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN4O2 |
|---|---|
| Molecular weight | 327.18 g/mol |
| IUPAC name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenol;hydrobromide |
| InChIKey | GHBRBLNGRSGPEP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC2=CN=C(N=C2N)N)O.Br |
Computed by PubChem (NCBI)