CAS 2768385-71-1 is the registry number for tert-Butyl 3-bromo-2-cyano-5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-bromo-2-cyano-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate (CAS 2768385-71-1) is a chemical compound with the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. IUPAC name: tert-butyl 3-bromo-2-cyano-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate. InChIKey: FNPKIMALDWHNTP-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN4O2 |
|---|---|
| Molecular weight | 327.18 g/mol |
| IUPAC name | tert-butyl 3-bromo-2-cyano-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate |
| InChIKey | FNPKIMALDWHNTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=NC(=C2Br)C#N)C1 |
Computed by PubChem (NCBI)