CAS 2681299-21-6 is the registry number for tert-Butyl ((5-bromo-3H-imidazo[4,5-b]pyridin-2-yl)methyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(5-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl]carbamate (CAS 2681299-21-6) is a chemical compound with the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. IUPAC name: tert-butyl N-[(5-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl]carbamate. InChIKey: HENDRHGFGAKPFN-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN4O2 |
|---|---|
| Molecular weight | 327.18 g/mol |
| IUPAC name | tert-butyl N-[(5-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl]carbamate |
| InChIKey | HENDRHGFGAKPFN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC2=C(N1)C=CC(=N2)Br |
Computed by PubChem (NCBI)