Products 122453-98-9
CAS 122453-98-9 appears in our catalog under these names: 4-(4-Chlorophenyl)-1H-pyrrole-3-carboxylic acid, 97%, 97%, 4-(4-Chlorophenyl)-1H-pyrrole-3-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-chlorophenyl)-1H-pyrrole-3-carboxylic acid (CAS 122453-98-9) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 4-(4-chlorophenyl)-1H-pyrrole-3-carboxylic acid. InChIKey: AQBPGMPHZORECB-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1H-pyrrole-3-carboxylic acid |
| InChIKey | AQBPGMPHZORECB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC=C2C(=O)O)Cl |
Computed by PubChem (NCBI)