Products 1225138-96-4
CAS 1225138-96-4 is the registry number for 2-[(5-Methyl-1,3,4-oxadiazol-2-yl)methyl]isoindole-1,3-dione, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]isoindole-1,3-dione (CAS 1225138-96-4) is a chemical compound with the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. IUPAC name: 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]isoindole-1,3-dione. InChIKey: RMLZRPMQOFIOFG-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O3 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]isoindole-1,3-dione |
| InChIKey | RMLZRPMQOFIOFG-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)CN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)