Products 717854-83-6
CAS 717854-83-6 is the registry number for 4-(Pyrazine-2-carboxamido)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(pyrazine-2-carbonylamino)benzoic acid (CAS 717854-83-6) is a chemical compound with the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. IUPAC name: 4-(pyrazine-2-carbonylamino)benzoic acid. InChIKey: AFAJVOBGIKEDMT-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O3 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 4-(pyrazine-2-carbonylamino)benzoic acid |
| InChIKey | AFAJVOBGIKEDMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC(=O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)