CAS 1710271-75-2 is the registry number for Ethyl 5-(3-cyanophenyl)-1,3,4-oxadiazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(3-cyanophenyl)-1,3,4-oxadiazole-2-carboxylate (CAS 1710271-75-2) is a chemical compound with the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. IUPAC name: ethyl 5-(3-cyanophenyl)-1,3,4-oxadiazole-2-carboxylate. InChIKey: VTRYJVJUYVXCPY-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O3 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | ethyl 5-(3-cyanophenyl)-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | VTRYJVJUYVXCPY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)