CAS 1225218-67-6 is the registry number for tert-Butyl 3-(azidomethyl)pyrrolidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Tert-butyl 3-(azidomethyl)pyrrolidine-1-carboxylate (CAS 1225218-67-6) is a chemical compound with the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. IUPAC name: tert-butyl 3-(azidomethyl)pyrrolidine-1-carboxylate. InChIKey: AQMRWLAIZUYEIP-UHFFFAOYSA-N.
| Molecular formula | C10H18N4O2 |
|---|---|
| Molecular weight | 226.28 g/mol |
| IUPAC name | tert-butyl 3-(azidomethyl)pyrrolidine-1-carboxylate |
| InChIKey | AQMRWLAIZUYEIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)