CAS 889062-05-9 appears in our catalog under these names: Amicarbazone Impurity 1, N-tert-Butyl-3-isopropyl-5-oxo-4,5-dihydro-1H-1,2,4-triazole-1-carboxamide, >95% (HPLC), Amicarbazone-desamino, Amicarbazone-desamino 100 µg/mL in Acetonitrile, N-tert-Butyl-3-isopropyl-5-oxo-4,5-dihydro-1H-1,2,4-triazole-1-carboxamide. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: on request, 100mg, 250mg, 50mg, 25mg, 1ml.
N-tert-butyl-5-oxo-3-propan-2-yl-4H-1,2,4-triazole-1-carboxamide (CAS 889062-05-9) is a chemical compound with the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. IUPAC name: N-tert-butyl-5-oxo-3-propan-2-yl-4H-1,2,4-triazole-1-carboxamide. InChIKey: ROZCMVNPWNQNEH-UHFFFAOYSA-N.
| Molecular formula | C10H18N4O2 |
|---|---|
| Molecular weight | 226.28 g/mol |
| IUPAC name | N-tert-butyl-5-oxo-3-propan-2-yl-4H-1,2,4-triazole-1-carboxamide |
| InChIKey | ROZCMVNPWNQNEH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=O)N1)C(=O)NC(C)(C)C |
Computed by PubChem (NCBI)