CAS 168049-26-1 appears in our catalog under these names: (S)–2–(Azidomethyl)–1–Boc–pyrrolidine, (S)-2-(Azidomethyl)-1-Boc-pyrrolidine, tert-Butyl-(S)-2-(azidomethyl)-1-pyrrolidine carboxylate, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 100mg.
Tert-butyl (2S)-2-(azidomethyl)pyrrolidine-1-carboxylate (CAS 168049-26-1) is a chemical compound with the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. IUPAC name: tert-butyl (2S)-2-(azidomethyl)pyrrolidine-1-carboxylate. InChIKey: HRLUZSSGBKDEGK-QMMMGPOBSA-N.
| Molecular formula | C10H18N4O2 |
|---|---|
| Molecular weight | 226.28 g/mol |
| IUPAC name | tert-butyl (2S)-2-(azidomethyl)pyrrolidine-1-carboxylate |
| InChIKey | HRLUZSSGBKDEGK-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CN=[N+]=[N-] |
Computed by PubChem (NCBI)