Products 1225227-24-6

CAS 1225227-24-6 is the registry number for 3-(5-Azetidin-3-yl-1,2,4-oxadiazol-3-yl)pyridine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(azetidin-3-yl)-3-pyridin-3-yl-1,2,4-oxadiazole (CAS 1225227-24-6) is a chemical compound with the molecular formula C10H10N4O and a molecular weight of 202.21 g/mol. IUPAC name: 5-(azetidin-3-yl)-3-pyridin-3-yl-1,2,4-oxadiazole. InChIKey: IONUYLBXYUMKSG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N4O
Molecular weight202.21 g/mol
IUPAC name5-(azetidin-3-yl)-3-pyridin-3-yl-1,2,4-oxadiazole
InChIKeyIONUYLBXYUMKSG-UHFFFAOYSA-N
SMILESC1C(CN1)C2=NC(=NO2)C3=CN=CC=C3

Computed by PubChem (NCBI)