CAS 941400-50-6 appears in our catalog under these names: 1-[4-(1H-1,2,4-Triazol-1-yl)phenyl]ethanone oxime, 95%, N-{1-(4-(1H-1,2,4-Triazol-1-yl)phenyl)ethylidene}hydroxylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(NE)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethylidene]hydroxylamine (CAS 941400-50-6) is a chemical compound with the molecular formula C10H10N4O and a molecular weight of 202.21 g/mol. IUPAC name: (NE)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethylidene]hydroxylamine. InChIKey: VVOXRSCTXMFUFJ-MDWZMJQESA-N.
| Molecular formula | C10H10N4O |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | (NE)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethylidene]hydroxylamine |
| InChIKey | VVOXRSCTXMFUFJ-MDWZMJQESA-N |
| SMILES | C/C(=N\O)/C1=CC=C(C=C1)N2C=NC=N2 |
Computed by PubChem (NCBI)