CAS 15966-44-6 is the registry number for 5-Methyl-1-phenyl-1h-1,2,4-triazole-3-carboxamide, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-methyl-1-phenyl-1,2,4-triazole-3-carboxamide (CAS 15966-44-6) is a chemical compound with the molecular formula C10H10N4O and a molecular weight of 202.21 g/mol. IUPAC name: 5-methyl-1-phenyl-1,2,4-triazole-3-carboxamide. InChIKey: VEJVDXSNUZGFSY-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 5-methyl-1-phenyl-1,2,4-triazole-3-carboxamide |
| InChIKey | VEJVDXSNUZGFSY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)