CAS 2942396-29-2 appears in our catalog under these names: Tubulin polymerization-IN-55, 98%, Tubulin polymerization-IN-55/ 98.68% (existing batch purity), Tubulin polymerization–IN–55, Tubulin polymerization-IN-55 98%, 1-(1-Ethyl-1H-indol-5-yl)-5,6,7-trimethoxy-2,3-dihydroquinolin-4(1H)-one. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
1-(1-ethylindol-5-yl)-5,6,7-trimethoxy-2,3-dihydroquinolin-4-one (CAS 2942396-29-2) is a chemical compound with the molecular formula C22H24N2O4 and a molecular weight of 380.4 g/mol. IUPAC name: 1-(1-ethylindol-5-yl)-5,6,7-trimethoxy-2,3-dihydroquinolin-4-one. InChIKey: DTEIZRBQUNGXFO-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O4 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 1-(1-ethylindol-5-yl)-5,6,7-trimethoxy-2,3-dihydroquinolin-4-one |
| InChIKey | DTEIZRBQUNGXFO-UHFFFAOYSA-N |
| SMILES | CCN1C=CC2=C1C=CC(=C2)N3CCC(=O)C4=C(C(=C(C=C43)OC)OC)OC |
Computed by PubChem (NCBI)