CAS 1225444-76-7 appears in our catalog under these names: 1-Phenyl-1H-1,2,4-triazol-3-amine, 95%, 1-Phenyl-1H-1,2,4-triazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-phenyl-1,2,4-triazol-3-amine (CAS 1225444-76-7) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 1-phenyl-1,2,4-triazol-3-amine. InChIKey: UPZZNNQSHZBTAQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 1-phenyl-1,2,4-triazol-3-amine |
| InChIKey | UPZZNNQSHZBTAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC(=N2)N |
Computed by PubChem (NCBI)