Products 1225526-82-8

CAS 1225526-82-8 is the registry number for 2-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyacetic acid (CAS 1225526-82-8) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyacetic acid. InChIKey: YUCQTIDHUKAFFK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O5
Molecular weight210.18 g/mol
IUPAC name2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyacetic acid
InChIKeyYUCQTIDHUKAFFK-UHFFFAOYSA-N
SMILESC1COC2=C(O1)C=CC(=C2)C(C(=O)O)O

Computed by PubChem (NCBI)