Products 1225538-24-8
CAS 1225538-24-8 is the registry number for 6-(2,4-Dimethylphenyl)picolinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
6-(2,4-dimethylphenyl)pyridine-2-carboxylic acid (CAS 1225538-24-8) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 6-(2,4-dimethylphenyl)pyridine-2-carboxylic acid. InChIKey: DAXMWEXZZVTQDV-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 6-(2,4-dimethylphenyl)pyridine-2-carboxylic acid |
| InChIKey | DAXMWEXZZVTQDV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NC(=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)