CAS 1225573-65-8 is the registry number for (3-Bromophenyl)-4-piperidinyl-methanone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3-bromophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 1225573-65-8) is a chemical compound with the molecular formula C12H15BrClNO and a molecular weight of 304.61 g/mol. IUPAC name: (3-bromophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: KMRJBORWXXBHRH-UHFFFAOYSA-N.
| Molecular formula | C12H15BrClNO |
|---|---|
| Molecular weight | 304.61 g/mol |
| IUPAC name | (3-bromophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | KMRJBORWXXBHRH-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)