CAS 2126178-83-2 is the registry number for 6-Bromospiro(chromane-2,1'-cyclobutan)-4-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromospiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine;hydrochloride (CAS 2126178-83-2) is a chemical compound with the molecular formula C12H15BrClNO and a molecular weight of 304.61 g/mol. IUPAC name: 6-bromospiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine;hydrochloride. InChIKey: KSYRKIYGSHFGIC-UHFFFAOYSA-N.
| Molecular formula | C12H15BrClNO |
|---|---|
| Molecular weight | 304.61 g/mol |
| IUPAC name | 6-bromospiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine;hydrochloride |
| InChIKey | KSYRKIYGSHFGIC-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(C3=C(O2)C=CC(=C3)Br)N.Cl |
Computed by PubChem (NCBI)