CAS 2126177-19-1 is the registry number for 7-Bromo-4,5-dihydro-3H-spiro(1,4-benzoxazepine-2,1'-cyclobutane) hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-bromospiro[4,5-dihydro-3H-1,4-benzoxazepine-2,1'-cyclobutane];hydrochloride (CAS 2126177-19-1) is a chemical compound with the molecular formula C12H15BrClNO and a molecular weight of 304.61 g/mol. IUPAC name: 7-bromospiro[4,5-dihydro-3H-1,4-benzoxazepine-2,1'-cyclobutane];hydrochloride. InChIKey: OERRRJAIOBIHBW-UHFFFAOYSA-N.
| Molecular formula | C12H15BrClNO |
|---|---|
| Molecular weight | 304.61 g/mol |
| IUPAC name | 7-bromospiro[4,5-dihydro-3H-1,4-benzoxazepine-2,1'-cyclobutane];hydrochloride |
| InChIKey | OERRRJAIOBIHBW-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNCC3=C(O2)C=CC(=C3)Br.Cl |
Computed by PubChem (NCBI)