CAS 1225595-21-0 is the registry number for 2-(3-Acetylphenyl)-1,2-thiazolidine-1,1-dione. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanone (CAS 1225595-21-0) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanone. InChIKey: MHESZAMGLKXOGD-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanone |
| InChIKey | MHESZAMGLKXOGD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N2CCCS2(=O)=O |
Computed by PubChem (NCBI)