Products 122565-29-1
CAS 122565-29-1 appears in our catalog under these names: (R)–2–Amino–5,5,5–trifluoropentanoic acid, (R)-2-Amino-5,5,5-trifluoropentanoic acid, 95%, 95%, (R)-2-Amino-5,5,5-trifluoro-pentanoic acid, 95%, H-D-Nva(5,5,5-triF)-OH, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg, 5g.
(2R)-2-amino-5,5,5-trifluoropentanoic acid (CAS 122565-29-1) is a chemical compound with the molecular formula C5H8F3NO2 and a molecular weight of 171.12 g/mol. IUPAC name: (2R)-2-amino-5,5,5-trifluoropentanoic acid. InChIKey: KTZZIDWVKLDWBF-GSVOUGTGSA-N.
| Molecular formula | C5H8F3NO2 |
|---|---|
| Molecular weight | 171.12 g/mol |
| IUPAC name | (2R)-2-amino-5,5,5-trifluoropentanoic acid |
| InChIKey | KTZZIDWVKLDWBF-GSVOUGTGSA-N |
| SMILES | C(CC(F)(F)F)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-Amino-5,5,5-trifluoropentanoic acid, (2R)-2-amino-5,5,5-trifluoropentanoic acid, D-Norvaline, 5,5,5-trifluoro-, 5,5,5-Trifluoro-D-norvaline, (R)-2-Amino-5,5,5-trifluoro-pentanoic acid, (2R)-2-amino-5,5,5-trifluoropentanoicacid, (2R)-2-azaniumyl-5,5,5-trifluoropentanoate, (r)-5,5,5-trifluronorvaline, (r)-5,5,5-trifluoronorvaline, (R) 2-Amino-5,5,5-trifluorovaleric acid