CAS 1225707-02-7 is the registry number for Cyclopropyl(3,5-difluorophenyl)methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Cyclopropyl-(3,5-difluorophenyl)methanamine (CAS 1225707-02-7) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: cyclopropyl-(3,5-difluorophenyl)methanamine. InChIKey: ANHZONLVPOXZML-UHFFFAOYSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | cyclopropyl-(3,5-difluorophenyl)methanamine |
| InChIKey | ANHZONLVPOXZML-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=CC(=C2)F)F)N |
Computed by PubChem (NCBI)