CAS 1241683-70-4 appears in our catalog under these names: (2R)-2-(3,5-Difluorophenyl)pyrrolidine, 95%, (R)–2–(3,5–Difluorophenyl)pyrrolidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
(2R)-2-(3,5-difluorophenyl)pyrrolidine (CAS 1241683-70-4) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: (2R)-2-(3,5-difluorophenyl)pyrrolidine. InChIKey: INAOTHVFVJELEL-SNVBAGLBSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | (2R)-2-(3,5-difluorophenyl)pyrrolidine |
| InChIKey | INAOTHVFVJELEL-SNVBAGLBSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)