CAS 536695-21-3 appears in our catalog under these names: Cyclopropyl(2,5-difluorophenyl)methanamine, 95%, Cyclopropyl(2,5-difluorophenyl)methanamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Cyclopropyl-(2,5-difluorophenyl)methanamine (CAS 536695-21-3) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: cyclopropyl-(2,5-difluorophenyl)methanamine. InChIKey: WTUQJXAMZDXBID-UHFFFAOYSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | cyclopropyl-(2,5-difluorophenyl)methanamine |
| InChIKey | WTUQJXAMZDXBID-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C=CC(=C2)F)F)N |
Computed by PubChem (NCBI)