CAS 1225922-11-1 is the registry number for 5-Chloro-3-isopropylindolin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-propan-2-yl-1,3-dihydroindol-2-one (CAS 1225922-11-1) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: 5-chloro-3-propan-2-yl-1,3-dihydroindol-2-one. InChIKey: YJGBLJHZCIRCPH-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 5-chloro-3-propan-2-yl-1,3-dihydroindol-2-one |
| InChIKey | YJGBLJHZCIRCPH-UHFFFAOYSA-N |
| SMILES | CC(C)C1C2=C(C=CC(=C2)Cl)NC1=O |
Computed by PubChem (NCBI)