Products 1225971-07-2
CAS 1225971-07-2 is the registry number for Hepatoprotective agent-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-chlorophenyl)-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile (CAS 1225971-07-2) is a chemical compound with the molecular formula C16H13ClN2O and a molecular weight of 284.74 g/mol. IUPAC name: 4-(4-chlorophenyl)-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile. InChIKey: JWIBBJIYIGLMKH-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile |
| InChIKey | JWIBBJIYIGLMKH-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(C(=O)N2)C#N)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)