CAS 1226149-97-8 is the registry number for 2-(3,5-Dimethylphenyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3,5-dimethylphenyl)propanoic acid (CAS 1226149-97-8) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)propanoic acid. InChIKey: HINDWPQRDXPURN-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)propanoic acid |
| InChIKey | HINDWPQRDXPURN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C)C(=O)O)C |
Computed by PubChem (NCBI)