Products 1226304-46-6

CAS 1226304-46-6 is the registry number for 2-(3-BROMOPHENYL)-3-METHYLBUTANOIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-bromophenyl)-3-methylbutanoic acid (CAS 1226304-46-6) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 2-(3-bromophenyl)-3-methylbutanoic acid. InChIKey: KSWGPYWKISIVQN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BrO2
Molecular weight257.12 g/mol
IUPAC name2-(3-bromophenyl)-3-methylbutanoic acid
InChIKeyKSWGPYWKISIVQN-UHFFFAOYSA-N
SMILESCC(C)C(C1=CC(=CC=C1)Br)C(=O)O

Computed by PubChem (NCBI)