CAS 1226507-77-2 is the registry number for 2,2,2-Trifluoro-1-(5-fluoropyridin-3-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(5-fluoro-3-pyridinyl)ethanol (CAS 1226507-77-2) is a chemical compound with the molecular formula C7H5F4NO and a molecular weight of 195.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-(5-fluoro-3-pyridinyl)ethanol. InChIKey: OZHGECLMCXQSLT-UHFFFAOYSA-N.
| Molecular formula | C7H5F4NO |
|---|---|
| Molecular weight | 195.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(5-fluoro-3-pyridinyl)ethanol |
| InChIKey | OZHGECLMCXQSLT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1F)C(C(F)(F)F)O |
Computed by PubChem (NCBI)