CAS 1227600-70-5 is the registry number for (3-fluoro-2-(trifluoromethyl)pyridin-4-yl)methanol, 97%. Offered by: AmBeed. Available pack sizes: 5g.
[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methanol (CAS 1227600-70-5) is a chemical compound with the molecular formula C7H5F4NO and a molecular weight of 195.11 g/mol. IUPAC name: [3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methanol. InChIKey: VYSLSJVNWYPWBI-UHFFFAOYSA-N.
| Molecular formula | C7H5F4NO |
|---|---|
| Molecular weight | 195.11 g/mol |
| IUPAC name | [3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methanol |
| InChIKey | VYSLSJVNWYPWBI-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1CO)F)C(F)(F)F |
Computed by PubChem (NCBI)