CAS 123572-66-7 appears in our catalog under these names: 4-Fluoro-2-(trifluoromethoxy)aniline, 95%, 4-Fluoro-2-(trifluoromethoxy)aniline, 95+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 25g.
4-fluoro-2-(trifluoromethoxy)aniline (CAS 123572-66-7) is a chemical compound with the molecular formula C7H5F4NO and a molecular weight of 195.11 g/mol. IUPAC name: 4-fluoro-2-(trifluoromethoxy)aniline. InChIKey: QFDKCJQODJFZID-UHFFFAOYSA-N.
| Molecular formula | C7H5F4NO |
|---|---|
| Molecular weight | 195.11 g/mol |
| IUPAC name | 4-fluoro-2-(trifluoromethoxy)aniline |
| InChIKey | QFDKCJQODJFZID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OC(F)(F)F)N |
Computed by PubChem (NCBI)