Products 1226880-11-0
CAS 1226880-11-0 is the registry number for 1-(6-Bromo-5-methoxypyridin-2-yl)ethanone, 95+%. Offered by: Ambeed. Available pack sizes: 1g.
1-(6-bromo-5-methoxy-2-pyridinyl)ethanone (CAS 1226880-11-0) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-(6-bromo-5-methoxy-2-pyridinyl)ethanone. InChIKey: CQRAOIBFYFMYLM-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-(6-bromo-5-methoxy-2-pyridinyl)ethanone |
| InChIKey | CQRAOIBFYFMYLM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC(=C(C=C1)OC)Br |
Computed by PubChem (NCBI)