Products 1226892-20-1
CAS 1226892-20-1 appears in our catalog under these names: Norpterosin B, (2R)-Norpterosin B. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, Get quote.
(2R)-6-(hydroxymethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one (CAS 1226892-20-1) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: (2R)-6-(hydroxymethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one. InChIKey: FUOYIVLWRSGBHK-MRVPVSSYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | (2R)-6-(hydroxymethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one |
| InChIKey | FUOYIVLWRSGBHK-MRVPVSSYSA-N |
| SMILES | C[C@@H]1CC2=C(C1=O)C(=C(C(=C2)C)CO)C |
Computed by PubChem (NCBI)