Products 1226899-66-6
CAS 1226899-66-6 is the registry number for Lactoyl-L-tyrosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-(4-hydroxyphenyl)-2-(2-hydroxypropanoylamino)propanoic acid (CAS 1226899-66-6) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-(2-hydroxypropanoylamino)propanoic acid. InChIKey: XBOGARDIMVJTKF-MHPPCMCBSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-(2-hydroxypropanoylamino)propanoic acid |
| InChIKey | XBOGARDIMVJTKF-MHPPCMCBSA-N |
| SMILES | CC(C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
N-Lactoyl-Tyrosine, orb3143554