CAS 1227267-30-2 is the registry number for 2,6-Dimethylindole-3-benzyl carboxylate. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
Benzyl 2,6-dimethyl-1H-indole-3-carboxylate (CAS 1227267-30-2) is a chemical compound with the molecular formula C18H17NO2 and a molecular weight of 279.3 g/mol. IUPAC name: benzyl 2,6-dimethyl-1H-indole-3-carboxylate. InChIKey: SDRXDEDNGYPLSJ-UHFFFAOYSA-N.
| Molecular formula | C18H17NO2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | benzyl 2,6-dimethyl-1H-indole-3-carboxylate |
| InChIKey | SDRXDEDNGYPLSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C(N2)C)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)