Products 1227563-14-5
CAS 1227563-14-5 is the registry number for 2-(3-Bromo-2-hydroxypyridin-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3-bromo-2-oxo-1H-pyridin-4-yl)acetic acid (CAS 1227563-14-5) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 2-(3-bromo-2-oxo-1H-pyridin-4-yl)acetic acid. InChIKey: AHPSNPBGNZTQHN-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 2-(3-bromo-2-oxo-1H-pyridin-4-yl)acetic acid |
| InChIKey | AHPSNPBGNZTQHN-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C(=C1CC(=O)O)Br |
Computed by PubChem (NCBI)